Axitirome

This classification denotes an anti-lipidemic agent with the molecular formula C25H24FNO6, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier V477CK910J, chemically known as ethyl ( -)-((4-(3-((4-fluorophenyl)hydroxymethyl)-4-hydroxyphenoxy)-3,5-dimethylphenyl)amino)oxoacetate but generally known as axitirome, which bears US NIH Compound Identifier 166559. The term AXITIROME is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 14, No. 3, 2000, List 44). Most nations schedule axitirome under HS 29242995 and SITC 51479. As of Q4 2014, AXITIROME remains the US FDA Preferred Term for this commodity. Axitirome bears US NLM identifiers UMLS ID C2698282 and NCI Concept Code C75992. SMILES: CCOC(=O)C(=O)NC1=CC(=C(C(=C1)C)OC2=CC(=C(C=C2)O)C(C3=CC=C(C=C3)F)O)C.