Pirinixic acid

This classification denotes an organic carcinogen with the molecular formula C14H14ClN3O2S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 86C4MRT55A, chemically known as 4-chloro-6-(2,3-xylidino)-2-pyrimidinylthioacetic acid but generally known as pirinixic acid, which bears US NIH Compound Identifier 5694. European Medicines Agency schedules Pirinixic acid in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB09915MIG. The term PIRINIXIC ACID is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 35, No. 5 1981, List 21). Most nations schedule pirinixic acid under HS 29335995 and SITC 51576. As of Q4 2014, PIRINIXIC ACID remains the US FDA Preferred Term for this commodity. Pirinixic acid bears US NLM identifiers UMLS ID C0243266 and NCI Concept Code C29866. SMILES: Clc1nc(SCC(=O)O)nc(Nc2c(c(ccc2)C)C)c1.