Berupipam

This classification denotes a dopamine antagonist with the molecular formula C19H19BrClNO2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 420895MAOC, chemically known as (+)-(5s)-5-(5-bromo-2,3-dihydro-7-benzofuranyl)-8-chloro-2,3,4,5-tetrahydro-3-methyl-1h-3-benzazepin-7-ol but generally known as berupipam, which bears US NIH Compound Identifier 66002. European Medicines Agency schedules Berupipam in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB05784MIG. The term BERUPIPAM is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 9, No. 3, 1995, List 35). Most nations schedule berupipam under HS 29349990 and SITC 51579. As of Q4 2014, BERUPIPAM remains the US FDA Preferred Term for this commodity. Berupipam bears US NLM identifiers UMLS ID C0384052 and NCI Concept Code C81087. SMILES: BRC1CC(C2CN(CCC3C2CC(O)C(CL)C3)C)C2OCCC2C1.