Panamesine

This classification denotes an antipsychotic agent with the molecular formula C23H26N2O6, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier, 023D9E916L chemically known as (5s)-5-((4-hydroxy-4-(3,4-(methylenedioxy)phenyl)piperidino)methyl)-3-(p-methoxyphenyl)-2-oxazolidinone but generally known as panamesine, which bears US NIH Compound Identifier 3047810. European Medicines Agency schedules Panamesine in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB09601MIG. The term PANAMESINE is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 10, no. 3, 1996, list 36. ). Most nations schedule panamesine under HS 29349990 and SITC 51579. As of Q4 2014, PANAMESINE remains the US FDA Preferred Term for this commodity. Panamesine bears US NLM identifiers UMLS ID C0663536 and NCI Concept Code C66301. SMILES: COC1=CC=C(C=C1)N2C[C@@H](OC2=O)CN3CCC(CC3)(C4=CC5=C(C=C4)OCO5)O.