Clopipazan

This classification denotes an antipsychotic agent with the molecular formula C19H18ClNO, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier F6S9CMY4SE, chemically known as 4-(2-chloroxanthen-9-ylidene)-1-methylpiperidine but generally known as clopipazan, which bears US NIH Compound Identifier 43215. European Medicines Agency schedules Clopipazan in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB06741MIG. Most nations schedule clopipazan under HS 29349990 and SITC 51579. As of Q4 2014, CLOPIPAZAN remains the US FDA Preferred Term for this commodity. Clopipazan bears US NLM identifiers UMLS ID C2699376 and NCI Concept Code C79944. SMILES: CN1CCC(=C2C3=CC=CC=C3OC4=C2C=C(C=C4)Cl)CC1.