Loxapine succinate

This classification denotes an antipsychotic agent with the molecular formula C18H18ClN3O.C4H6O4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier X59SG0MRYU, chemically known as 1,4-butanedioic acid (succinic acid) but more generally known as loxapine succinate, which bears US NIH Compound Identifier 1110. European Medicines Agency schedules Loxapine succinate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB02977MIG. Most nations, for tariff and trade purposes, schedule loxapine succinate under HS 29349990 and SITC 51579. As of Q4 2014, LOXAPINE SUCCINATE remains US FDA's Preferred Term for this commodity. Loxapine succinate bears US NLM identifiers UMLS ID C0024057 and NCI Concept Code C47590. SMILES: CN1CCN(CC1)C2=NC3CCCCC3OC4C2CC(CC4)CL.C(CC(=O)O)C(=O)O.