Nelfinavir mesilate or mesylate

This classification denotes a protease inhibitor with the molecular formula C32H45N3O4S.CH4O3S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 98D603VP8V, chemically known as (3s,4as,8as)-n-tert-butyl-2-((2r,3r)-3-(3,2-cresotamido)-2-hydroxy-4-(phenylthio)butyl)decahydro-3-isoquinolinecarboxamide monomethanesulfonate (salt), but more generally known as nelfinavir mesylate, which bears US NIH Compound Identifier 64142. European Medicines Agency schedules nelfinavir mesylate or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB09186MIG. Most nations, for tariff purposes, schedule nelfinavir mesylate under HS 29334990. As of Q4 2014, NELFINAVIR MESYLATE remains US FDA's Preferred Term for this commodity. Nelfinavir mesylate bears US NLM identifiers UMLS ID C0886530 and NCI Concept Code C1624. SMILES: CC1C(CCCC1O)C(=O)N[C@@H](CSC2CCCCC2)[C@@H](CN3C[C@H]4CCCC[C@H]4C[C@H]3C(=O)NC(C)(C)C)O.CS(=O)(=O)O.