Vidarabine anhydrous

This classification denotes a purine antagonist and antiviral agent with the molecular formula C10H13N5O4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 3XQD2MEW34, chemically known as vidarabine, anhydrous, but more generally known as vidarabine anhydrous, which bears US NIH Compound Identifier 21704. European Medicines Agency schedules vidarabine anhydrous or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB00047MIG. Most nations, for tariff purposes, schedule vidarabine anhydrous under HS 29349990. Vidarabine anhydrous bears US NLM identifiers UMLS ID C2700247 and NCI Concept Code C77393. SMILES: C1NC(C2C(N1)N(CN2)[C@H]3[C@H]([C@@H]([C@H](O3)CO)O)O)N.