Peramivir

This classification denotes an antiviral agent with the molecular formula C15H28N4O4.3H2O, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier QW7Y7ZR15U, chemically known as cyclopentanecarboxylic acid, 3-((1s)-1-(acetylamino)-2-ethylbutyl)-4-((aminoiminomethyl)amino)-2-hydroxy-, (1s,2s,3r,4r)- but generally known as peramivir, which bears US NIH Compound Identifier 151164. European Medicines Agency schedules Peramivir in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB32136. Most nations schedule peramivir under HS 29252900 and SITC 51482. As of Q4 2014, PERAMIVIR remains the US FDA Preferred Term for this commodity. Peramivir bears US NLM identifiers UMLS ID C1675326 and NCI Concept Code C81611. SMILES: OC1C(C(/N=C(/N)N)CC1C(=O)O)C(NC(=O)C)C(CC)CC.