Tenofovir

This classification denotes a reverse transcriptase inhibitor and purine antagonist with the molecular formula C9H14N5O4P.H2O, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 99YXE507IL, chemically known as phosphonic acid, ((2-(6-amino-9h-purin-9-yl)-1-methylethoxy)methyl)-, (r)- but generally known as tenofovir, which bears US NIH Compound Identifier 464205. European Medicines Agency schedules Tenofovir in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB04721MIG. Most nations schedule tenofovir under HS 29335995 and SITC 51576. As of Q4 2014, TENOFOVIR remains the US FDA Preferred Term for this commodity. Tenofovir bears US NLM identifiers UMLS ID C0384228 and NCI Concept Code C29490. SMILES: P(=O)(O)(O)COC(Cn1c2ncnc(N)c2nc1)C.