Etynodiol diacetate

This classification denotes a therapeutic progestin with the molecular formula C24H32O4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 62H10A1236, chemically known as 19-norpregn-4-en-20-yne-3,17-diol, diacetate, (3.beta.,17.alpha.)- but more generally known as ethynodiol diacetate, which bears US NIH Compound Identifier 3304. European Medicines Agency schedules Etynodiol diacetate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB02051MIG. Most nations, for tariff and trade purposes, schedule etynodiol diacetate under HS 29372300 and SITC 54153. SMILES: CC(=O)O[C@H]1CC[C@@H]2[C@H]3CC[C@]4([C@H]([C@@H]3CCC2=C1)CC[C@]4(C#C)OC(=O)C)C.