Diethylstilbestrol dipropionate

This classification denotes a non-steroidal estrogen with the molecular formula C24H28O4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier Y98CK3J0OL, chemically known as 4,4-stilbenediol, alpha,alpha-diethyl-, dipropionate, trans- but more generally known as diethylstilbestrol dipropionate, which bears US NIH Compound Identifier 657220. European Medicines Agency schedules Diethylstilbestrol dipropionate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB32995. Most nations, for tariff and trade purposes, schedule diethylstilbestrol dipropionate under HS 29072900. As of Q4 2014, DIETHYLSTILBESTROL DIPROPIONATE remains US FDA's Preferred Term for this commodity. Diethylstilbestrol dipropionate bears US NLM identifiers UMLS ID C0057965 and NCI Concept Code C74557. SMILES: CC/C(=C(/CC)\C1CCC(CC1)OC(=O)CC)/C2CCC(CC2)OC(=O)CC.