Fenadiazole

This classification denotes a sedative and hypnotic with the molecular formula C8H6N2O2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 8YX6HIZ0IP, chemically known as 1,3,4-oxadiazole, 2-(o-hydroxyphenyl)- but generally known as fenadiazole, which bears US NIH Compound Identifier 5359546. The term FENADIAZOLE is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 19 1975, List 5). FENADIAZOLE is scheduled in the U.S. International Trade Commission's Harmonized Tariff System (HTS) Pharmaceutical Appendix. Most nations schedule fenadiazole under HS 29349990 and SITC 51579. As of Q4 2014, FENADIAZOLE remains the US FDA Preferred Term for this commodity. Fenadiazole bears US NLM identifiers UMLS ID C1880747 and NCI Concept Code C65635. SMILES: C1=C/C(=C\2/NN=CO2)/C(=O)C=C1.