Flurazepam monohydrochloride

This classification denotes a benzodiazepine with the molecular formula C21H23ClFN3O.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 7C4JH842IJ, chemically known as 2h-1,4-benzodiazepin-2-one, 7-chloro-1-(2-(diethylamino)ethyl)-5-(2-fluorophenyl)-1,3-dihydro-, hydrochloride (1:1), but more generally known as flurazepam monohydrochloride, which bears US NIH Compound Identifier 37368. European Medicines Agency schedules flurazepam monohydrochloride or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB07744MIG. Most nations, for tariff purposes, schedule flurazepam monohydrochloride under HS 29339190. Flurazepam monohydrochloride bears US NLM identifiers UMLS ID C0887259 and NCI Concept Code C98134. SMILES: CCN(CC)CCN1C2CCC(CC2C(=NCC1=O)C3CCCCC3F)CL.CL.