Metoserpate hydrochloride

This classification denotes a sedative and hypnotic with the molecular formula C24H32N2O5.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier KBO7409339, chemically known as 3.beta., 20.alpha.-yohimban-16.beta.-carboxylic acid, 11,17.alpha., 18.alpha.-trimethoxy-, methyl ester, monohydrochloride but more generally known as metoserpate hydrochloride, which bears US NIH Compound Identifier 14443. Most nations, for tariff and trade purposes, schedule metoserpate hydrochloride under HS 29399900 and SITC 54149. As of Q4 2014, METOSERPATE HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Metoserpate hydrochloride bears US NLM identifiers UMLS ID C0521930 and NCI Concept Code C76955. SMILES: COC1CCC2C(C1)[NH]C3C2CCN4[C@@H]3C[C@H]5[C@@H](C4)C[C@@H]([C@@H]([C@H]5C(=O)OC)OC)OC.CL.