Methaqualone hydrochloride

This classification denotes an anxiolytic with the molecular formula C16H14N2O.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier RJQ4G25ZRH, chemically known as 3,4-dihydro-2-methyl-4-oxo-3-o-tolylquinazoline but more generally known as methaqualone hydrochloride, which bears US NIH Compound Identifier 6292. European Medicines Agency schedules Methaqualone hydrochloride in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB03212MIG. Most nations, for tariff and trade purposes, schedule methaqualone hydrochloride under HS 29335500 and SITC 51576. As of Q4 2014, METHAQUALONE HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Methaqualone hydrochloride bears US NLM identifiers UMLS ID C1522632 and NCI Concept Code C2484. SMILES: CC1CCCCC1N2C(NC3CCCCC3C2=O)C.CL.