Doxpicomine

This classification denotes an analgesic agent with the molecular formula C12H18N2O2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 9821373UA1, chemically known as 1-(1,3-dioxan-5-yl)-N,N-dimethyl-1-pyridin-3-ylmethanamine but generally known as doxpicomine, which bears US NIH Compound Identifier 71979. European Medicines Agency schedules doxpicomine in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB06392MIG. Most nations schedule doxpicomine under HS 29349990 and SITC 51579. As of Q4 2014, DOXPICOMINE remains the US FDA Preferred Term for this commodity. Doxpicomine bears US NLM identifiers UMLS ID C0058730 and NCI Concept Code C65477. SMILES: CN(C)C(C1COCOC1)C2=CN=CC=C2.Cl.