Promedol or trimeperidine

This classification denotes an opioid receptor agonist with the molecular formula C17H25NO2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 1M2IB31DTS, chemically known as 1,2,5-trimethyl-4-phenyl-4-propionyloxypiperidine but generally known as promedol, which bears US NIH Compound Identifier 6148. European Medicines Agency schedules Trimeperidine in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB11303MIG. The term PROMEDOL is an International Non-Proprietary Name. Promedol or trimeperidine bears US NLM identifiers UMLS ID C0041029 and NCI Concept Code C76848. SMILES: CCC(=O)OC1(C[C@@H](N(C[C@H]1C)C)C)C2=CC=CC=C2.