Difenpiramide

This classification denotes a non-steroidal anti-inflammatory agent and acetamide with the molecular formula C19H16N2O, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier Q6U5F6E1QL, chemically known as n-pyridin-2-yl(1,1-biphenyl)-4-acetamide but generally known as difenpiramide, which bears US NIH Compound Identifier 100472. World Health Organization schedules difenpiramide in its Anatomical Therapeutic Chemical (ATC) Classification. As of Q4 2014, DIFENPIRAMIDE remains the US FDA Preferred Term for this commodity. SMILES: C1=CC=C(C=C1)C2=CC=C(C=C2)CC(=O)NC3=CC=CC=N3.