Enfenamic acid

This classification denotes a nonsteroidal antiinflammatory drug with the molecular formula C15H15NO2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 05KO5G76R2, chemically known as benzoic acid, 2-(phenethylamino)- but generally known as enfenamic acid, which bears US NIH Compound Identifier 31635. European Medicines Agency schedules Enfenamic acid in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB06529MIG. The term ENFENAMIC ACID is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 35, No. 5 1981, List 21). Most nations schedule enfenamic acid under HS 29224995 and SITC 51465. As of Q4 2014, ENFENAMIC ACID remains the US FDA Preferred Term for this commodity. Enfenamic acid bears US NLM identifiers UMLS ID C0116077 and NCI Concept Code C72088. SMILES: C1=CC=C(C=C1)CCNC2=CC=CC=C2C(=O)O.