Diflumidone

This classification denotes a nonsteroidal antiinflammatory drug with the molecular formula C14H11F2NO3S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier, E96467495S chemically known as 3'-benzoyl-1,1-difluoromethanesulfonanilide but generally known as diflumidone, which bears US NIH Compound Identifier 31501. European Medicines Agency schedules Diflumidone in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB07129MIG. The term DIFLUMIDONE is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 23, no. 10 1969, list 9). Most nations schedule diflumidone under HS 29350090 and SITC 51580. As of Q4 2014, DIFLUMIDONE remains the US FDA Preferred Term for this commodity. Diflumidone bears US NLM identifiers UMLS ID C0057995 and NCI Concept Code C65384. SMILES: C1=CC=C(C=C1)C(=O)C2=CC(=CC=C2)NS(=O)(=O)C(F)F.