Tybamate

This classification denotes a carbamate anxiolytic with the molecular formula C13H26N2O4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 3875LLL8M8, chemically known as [2-(carbamoyloxymethyl)-2-methylpentyl] N-butylcarbamate but generally known as tybamate, which bears US NIH Compound Identifier 20266. European Medicines Agency schedules tybamate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB11369MIG. Most nations schedule tybamate under HS 29241900 and SITC 51471. As of Q4 2014, TYBAMATE remains the US FDA Preferred Term for this commodity. Tybamate bears US NLM identifiers UMLS ID C0175163 and NCI Concept Code C98240. SMILES: CCCCNC(=O)OCC(C)(CCC)COC(=O)N.