Sulindac sulfide

This classification denotes a cyclooxygenase inhibitor with the molecular formula C20H17FO2S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 6UVA8S2DEY, chemically known as sulindac sulfide, (z)-, but more generally known as sulindac sulfide, which bears US NIH Compound Identifier 91605. European Medicines Agency schedules sulindac sulfide or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB10744MIG. Most nations, for tariff purposes, schedule sulindac sulfide under HS 29309085. Sulindac sulfide bears US NLM identifiers UMLS ID C0075615 and NCI Concept Code C29854. SMILES: CC\1=C(C2CC(CCC2/C1=C\C3CCC(CC3)SC)F)CC(=O)O.