Clofexamide

This classification denotes a nonsteroidal antiinflammatory drug with the molecular formula C14H21ClN2O2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 071P4J77HF, chemically known as acetamide, 2-(p-chlorophenoxy)-n-(2-(diethylamino)ethyl)- but generally known as clofexamide, which bears US NIH Compound Identifier 28554. European Medicines Agency schedules Clofexamide in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB06704MIG. The term CLOFEXAMIDE is an International Non-Proprietary Name. CLOFEXAMIDE is scheduled in the U.S. International Trade Commission's Harmonized Tariff System (HTS) Pharmaceutical Appendix. Most nations schedule clofexamide under HS 29242995 and SITC 51479. As of Q4 2014, CLOFEXAMIDE remains the US FDA Preferred Term for this commodity. Clofexamide bears US NLM identifiers UMLS ID C0055906 and NCI Concept Code C77345. SMILES: CLC1CCC(OCC(=O)NCCN(CC)CC)CC1.