Diclofenac potassium

This classification denotes a cyclooxygenase inhibitor with the molecular formula C14H10Cl2NO2.K, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier L4D5UA6CB4, chemically known as 2-((2,6-dichlorophenyl)amino)benzeneacetic acid but more generally known as diclofenac potassium, which bears US NIH Compound Identifier 3033. European Medicines Agency schedules Diclofenac potassium in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB13568MIG. Most nations, for tariff and trade purposes, schedule diclofenac potassium under HS 29224995 and SITC 51465. As of Q4 2014, DICLOFENAC POTASSIUM remains US FDA's Preferred Term for this commodity. Diclofenac potassium bears US NLM identifiers UMLS ID C0282131 and NCI Concept Code C47983. SMILES: C1CCC(C(C1)CC(=O)[O-])NC2C(CCCC2CL)CL.[K+].