Firocoxib

This classification denotes a cyclooxygenase inhibitor with the molecular formula C17H20O5S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier Y6V2W4S4WT, chemically known as 3-(cyclopropylmethoxy)-5,5-dimethyl-4-(4-(methylsulfonyl)phenyl)furan-2(5h)-one but generally known as firocoxib, which bears US NIH Compound Identifier 208910. The term FIROCOXIB is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 18, No. 1, 2004, List 51). As of Q4 2014, FIROCOXIB remains the US FDA Preferred Term for this commodity. Firocoxib bears US NLM identifiers UMLS ID C1453102 and NCI Concept Code C65686. SMILES: CC1(C(=C(C(=O)O1)OCC2CC2)C3=CC=C(C=C3)S(=O)(=O)C)C.