Tilmacoxib

This classification denotes a cyclooxygenase inhibitor with the molecular formula C16H19FN2O3S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier G6VI5P84SX, chemically known as 5-ethoxymethyl-7-fluoro-3-oxo-1,2,3,5-tetrahydrobenzo(4,5)imidazo(1,2a)pyridine-4-n-(2-fluorophenyl)carboxamide but generally known as tilmacoxib, which bears US NIH Compound Identifier 159271. The term TILMACOXIB is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 15 No. 3-4, 2001, List 46). Most nations schedule tilmacoxib under HS 29350090 and SITC 51580. As of Q4 2014, TILMACOXIB remains the US FDA Preferred Term for this commodity. Tilmacoxib bears US NLM identifiers UMLS ID C2699944 and NCI Concept Code C76640. SMILES: CC1=NC(=C(O1)C2=CC(=C(C=C2)S(=O)(=O)N)F)C3CCCCC3.