Exisulind

This classification denotes a cyclooxygenase inhibitor with the molecular formula C20H17FO4S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier K619IIG2R9, chemically known as 1h-indene-3-acetic acid, 5-fluoro-2-methy l-1-((4-(methylsulfonyl)phenyl)methylene)- but generally known as exisulind, which bears US NIH Compound Identifier 5472495. The term EXISULIND is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 13 No. 3, 1999, List 42). Most nations schedule exisulind under HS 29309085 and SITC 51549. As of Q4 2014, EXISULIND remains the US FDA Preferred Term for this commodity. Exisulind bears US NLM identifiers UMLS ID C0075616 and NCI Concept Code C1239. SMILES: CC\1=C(C2=C(/C1=C\C3=CC=C(C=C3)S(=O)(=O)C)C=CC(=C2)F)CC(=O)O.