Rimiterol

This classification denotes a beta-adrenergic agonist with the molecular formula C22H32N2O6H2O4S; a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier U851S9102C; chemically known as 4;4-(hexane-1;6-diylbis(iminio(1-hydroxyethylene)))dipyrocatecholsulphate but generally known as hexoprenaline sulfate; which bears US National Institutes of Health Compound Identifier 36094 European Medicines Agency schedules Hexoprenaline sulfate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB02516MIG Most nations schedule rimiterol under HS 29333999 and SITC 51574. As of Q4 2014, RIMITEROL remains the US FDA Preferred Term for this commodity. Rimiterol bears US NLM identifiers UMLS ID C0035633 and NCI Concept Code C81639. SMILES: S(=O)(=O)(O)OOC(C[NH2]CCCCCC[NH2]CC(O)c1cc(O)c(O)cc1)c1cc(O)c(O)cc1S(=O)(=O)(O)OOC(C[NH2]CCCCCC[NH2]CC(O)c1cc(O)c(O)cc1)c1cc(O)c(O)cc1.