Metaraminol bitartrate

This classification denotes an alpha-adrenergic agonist with the molecular formula C9H13NO2.C4H6O6, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier ZC4202M9P3, chemically known as (-)-.alpha.-(1-aminoethyl)-m-hydroxybenzyl alcohol tartrate (1:1) (salt), but more generally known as metaraminol bitartrate, which bears US NIH Compound Identifier 5906. European Medicines Agency schedules metaraminol bitartrate or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB08815MIG. Most nations, for tariff purposes, schedule metaraminol bitartrate under HS 29399900. As of Q4 2014, METARAMINOL BITARTRATE remains US FDA's Preferred Term for this commodity. Metaraminol bitartrate bears US NLM identifiers UMLS ID C0025576 and NCI Concept Code C61836. SMILES: C[C@@H]([C@@H](C1CCCC(C1)O)O)N.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O.