Prinoxodan

This classification denotes a phosphodiesterase inhibitor with the molecular formula C13H14N4O2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier W4VMH2E80M, chemically known as 3,4-dihydro-3-methyl-6-(1,4,5,6-tetrahydro-6-oxo-3-pyridazinyl)-2(1h)-quinazolinone but generally known as prinoxodan, which bears US NIH Compound Identifier 5362397. European Medicines Agency schedules Prinoxodan in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB10048MIG. The term PRINOXODAN is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 5, No. 3 1991, List 31). Most nations schedule prinoxodan under HS 29335995 and SITC 51576. As of Q4 2014, PRINOXODAN remains the US FDA Preferred Term for this commodity. Prinoxodan bears US NLM identifiers UMLS ID C0165309 and NCI Concept Code C74349. SMILES: O=C1N(CC2C(N1)CCC(C2)C1=NNC(=O)CC1)C.