Piquizil

This classification denotes a bronchodilator with the molecular formula C19H26N4O4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 1K46616F1O, chemically known as 4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carboxylic acid isobutyl ester but generally known as piquizil, which bears US NIH Compound Identifier 192994. European Medicines Agency schedules piquizil in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB09891MIG. Most nations schedule piquizil under HS 29335995 and SITC 51576. As of Q4 2014, PIQUIZIL remains the US FDA Preferred Term for this commodity. SMILES: CC(C)COC(=O)N1CCN(CC1)C2=NC=NC3=CC(=C(C=C32)OC)OC.