Guanabenz acetate

This classification denotes an antihypertensive agent with the molecular formula C8H8Cl2N4.C2H4O2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 443O19GK1A, chemically known as (2,6-dichlorophenyl)methylideneaminoiminomethanediamine but more generally known as guanabenz acetate, which bears US NIH Compound Identifier 3517. European Medicines Agency schedules Guanabenz acetate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB02423MIG. Most nations, for tariff and trade purposes, schedule guanabenz acetate under HS 29280090 and SITC 51486. As of Q4 2014, GUANABENZ ACETATE remains US FDA's Preferred Term for this commodity. Guanabenz acetate bears US NLM identifiers UMLS ID C0733381 and NCI Concept Code C65826. SMILES: CC(=O)O.C1CC(C(C(C1)CL)/C=N/NC(=N)N)CL.