Acefylline

This classification denotes a bronchodilator with the molecular structure C9H10N4O4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier, M494UE2YEP chemically known as 1,2,3,6-tetrahydro-1,3-dimethyl-2,6-dioxopurine-7-acetic a but generally known as acefylline, which bears US NIH Compound Identifier 69550. European Medicines Agency schedules Acefylline in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB00243MIG. The term ACEFYLLINE is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 35, no. 5 1981, list 21). As of Q4 2014, ACEFYLLINE remains the US FDA Preferred Term for this commodity. Acefylline bears US NLM identifiers UMLS ID C0050405 and NCI Concept Code C96200. SMILES: CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CC(=O)O.