Bucladesine sodium

This classification denotes a phosphodiesterase inhibitor with the molecular formula C18H23N5O8P.Na, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 4DZN2C97A7, chemically known as sodium dibutyryl cyclic adenosine-3,5-monophosphate but more generally known as bucladesine sodium, which bears US NIH Compound Identifier 28177. European Medicines Agency schedules Bucladesine sodium in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB00888MIG. Most nations, for tariff and trade purposes, schedule bucladesine sodium under HS 29349990 and SITC 51579. As of Q4 2014, BUCLADESINE SODIUM remains US FDA's Preferred Term for this commodity. SMILES: CCCC(=O)NC1C2C(NCN1)N(CN2)[C@H]3[C@@H]([C@H]4[C@H](O3)COP(=O)(O4)[O-])OC(=O)CCC.[NA+].