Pelrinone

This classification denotes a phosphodiesterase inhibitor with the molecular formula C12H11N5O, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 9XK91ZI6I5, chemically known as 2-methyl-4-oxo-6-(pyridin-3-ylmethylamino)-1H-pyrimidine-5-carbonitrile but generally known as pelrinone, which bears US NIH Compound Identifier 55920. European Medicines Agency schedules pelrinone in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB09651MIG. Most nations schedule pelrinone under HS 29335995 and SITC 51576. As of Q4 2014, PELRINONE remains the US FDA Preferred Term for this commodity. SMILES: CC1=NC(=O)C(=C(N1)NCC2=CN=CC=C2)C#N.