Ipsapirone hydrochloride

This classification denotes a serotonin agonist and anxiolytic with the molecular formula C19H23N5O3S.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 08R5U8PYVO, chemically known as 1,2-benzisothiazol-3(2h)-one, 2-(4-(4-(2-pyrimidinyl)-1-piperazinyl)butyl)-, 1,1-dioxide, monohydrochloride but more generally known as ipsapirone hydrochloride, which bears US NIH Compound Identifier 71187. Most nations, for tariff and trade purposes, schedule ipsapirone hydrochloride under HS 29341000 and SITC 51579. As of Q4 2014, IPSAPIRONE HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Ipsapirone hydrochloride bears US NLM identifiers UMLS ID C2346591 and NCI Concept Code C72812. SMILES: C1CCC2C(C1)C(=O)N(S2(=O)=O)CCCCN3CCN(CC3)C4NCCCN4.CL.