Etafenone hydrochloride

This classification denotes a beta-adrenergic agonist with the molecular formula C21H27NO2.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier NTS160XKGC, chemically known as l.g.11,457 but more generally known as etafenone hydrochloride, which bears US NIH Compound Identifier 3275. European Medicines Agency schedules Etafenone hydrochloride in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB01980MIG. Most nations, for tariff and trade purposes, schedule etafenone hydrochloride under HS 29221980 and SITC 51461. As of Q4 2014, ETAFENONE HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Etafenone hydrochloride bears US NLM identifiers UMLS ID C0105278 and NCI Concept Code C95811. SMILES: CCN(CC)CCOC1CCCCC1C(=O)CCC2CCCCC2.CL.