Cinepazic acid

This classification denotes a vasodilating agent with the molecular formula C18H24N2O6, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier OX0J88C7UX, chemically known as 4-(3,4,5-trimethoxycinnamoyl)-1-piperazineacetic acid. but generally known as cinepazic acid, which bears US NIH Compound Identifier 6443799. European Medicines Agency schedules Cinepazic acid in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB06292MIG. The term CINEPAZIC ACID is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 26, No. 10 1972, List 12). Most nations schedule cinepazic acid under HS 29335995 and SITC 51576. As of Q4 2014, CINEPAZIC ACID remains the US FDA Preferred Term for this commodity. Cinepazic acid bears US NLM identifiers UMLS ID C2983978 and NCI Concept Code C91000. SMILES: O=C(N1CCN(CC1)CC(=O)O)/C=C/c1cc(OC)c(OC)c(OC)c1.