Clobetasone butyrate

This classification denotes a therapeutic glucocorticoid with the molecular formula C26H32ClFO5, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 8U0H6XI6EO, chemically known as 21-chloro-9-fluoro-17-hydroxy-16-methylpregna-1,4-diene-3,11,20-trione 17-butyrate but more generally known as clobetasone butyrate, which bears US NIH Compound Identifier 71386. European Medicines Agency schedules Clobetasone butyrate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB01347MIG. Most nations, for tariff and trade purposes, schedule clobetasone butyrate under HS 29372200 and SITC 54153. As of Q4 2014, CLOBETASONE BUTYRATE remains US FDA's Preferred Term for this commodity. Clobetasone butyrate bears US NLM identifiers UMLS ID C0055896 and NCI Concept Code C77409. SMILES: CCCC(=O)O[C@@]1([C@H](C[C@@H]2[C@@]1(CC(=O)[C@]3([C@H]2CCC4=CC(=O)C=C[C@@]43C)F)C)C)C(=O)CCL.