Cortisone acetate

This classification denotes a therapeutic glucocorticoid with the molecular formula C23H30O6, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 883WKN7W8X, chemically known as 4-pregnene-3,11,20-trione, 17alpha,21-dihydroxy-, 21-acetate but more generally known as cortisone acetate, which bears US NIH Compound Identifier 2863. European Medicines Agency schedules Cortisone acetate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB01467MIG. Most nations, for tariff and trade purposes, schedule cortisone acetate under HS 29372100 and SITC 54153. As of Q4 2014, CORTISONE ACETATE remains US FDA's Preferred Term for this commodity. Cortisone acetate bears US NLM identifiers UMLS ID C0056391 and NCI Concept Code C1058. SMILES: CC(=O)OCC(=O)[C@]1(CC[C@@H]2[C@@]1(CC(=O)[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C)O.