Triamcinolone diacetate

This classification denotes a therapeutic glucocorticoid with the molecular formula C25H31FO8, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier A73MM2Q32P, chemically known as 16alpha,21-diacetoxy-9alpha-fluoro-11beta,17alpha-dihydroxy-1,4-pregnadiene-3,20-dione but more generally known as triamcinolone diacetate, which bears US NIH Compound Identifier 6216. European Medicines Agency schedules Triamcinolone diacetate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB04938MIG. Most nations, for tariff and trade purposes, schedule triamcinolone diacetate under HS 29372200 and SITC 54153. As of Q4 2014, TRIAMCINOLONE DIACETATE remains US FDA's Preferred Term for this commodity. Triamcinolone diacetate bears US NLM identifiers UMLS ID C0040867 and NCI Concept Code C61985. SMILES: CC(=O)OCC(=O)[C@]1([C@@H](C[C@@H]2[C@@]1(C[C@@H]([C@]3([C@H]2CCC4=CC(=O)C=C[C@@]43C)F)O)C)OC(=O)C)O.