Exaprolol

This classification denotes a beta-adrenergic blocking agent with the molecular formula C18H29NO2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier, Q4XX54I93R chemically known as 2-propanol, 1-(2-cyclohexylphenoxy)-3-((1-methylethyl)amino)-,(+/-)- but generally known as exaprolol, which bears US NIH Compound Identifier 65485. European Medicines Agency schedules Exaprolol in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB07491MIG. The term EXAPROLOL is an International Non-Proprietary Name or INN. Most nations schedule exaprolol under HS 29221980 and SITC 51461. As of Q4 2014, EXAPROLOL remains the US FDA Preferred Term for this commodity. Exaprolol bears US NLM identifiers UMLS ID C0059928 and NCI Concept Code C65609. SMILES: CC(C)NCC(COC1=CC=CC=C1C2CCCCC2)O.