Dihydralazine sulfate

This classification denotes an antihypertensive agent with the molecular formula C8H10N6.H2O4S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 1C2B1W91NK, chemically known as 1,4-dihydrazinophthalazine sulfate but more generally known as dihydralazine sulfate, which bears US NIH Compound Identifier 81764. European Medicines Agency schedules Dihydralazine sulfate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB01702MIG. Most nations, for tariff and trade purposes, schedule dihydralazine sulfate under HS 29339990 and SITC 51577. As of Q4 2014, DIHYDRALAZINE SULFATE remains US FDA's Preferred Term for this commodity. Dihydralazine sulfate bears US NLM identifiers UMLS ID C0011569 and NCI Concept Code C81520. SMILES: C1CCC2C(C1)C(NNC2NN)NN.OS(=O)(=O)O.