Zofenoprilat

This classification denotes an ace inhibitor with the molecular formula C15H19NO3S2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 4G4WDK2YBS, chemically known as (2S,4S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]-4-phenylsulfanylpyrrolidine-2-carboxylic acid but generally known as zofenoprilat, which bears US NIH Compound Identifier 3034048. European Medicines Agency schedules zofenoprilat in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB00171MIG. Most nations schedule zofenoprilat under HS 29339990 and SITC 51577. As of Q4 2014, ZOFENOPRILAT remains the US FDA Preferred Term for this commodity. Zofenoprilat bears US NLM identifiers UMLS ID C0085065 and NCI Concept Code C95293. SMILES: CC(CS)C(=O)N1CC(CC1C(=O)O)SC2=CC=CC=C2.