Methoserpidine

This classification denotes an antiadrenergic agent with the molecular formula C33H40N2O9, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 8F8C1JQH53, chemically known as (-)-10-METHOXYDESERPIDINE but generally known as methoserpidine, which bears US NIH Compound Identifier 297930. The term methoserpidine is an International Non-Proprietary Name or INN. European Medicines Agency schedules methoserpidine in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB08855MIG. Most nations schedule methoserpidine under HS 29399900 and SITC 54149. As of Q4 2014, METHOSERPIDINE remains the US FDA Preferred Term for this commodity. SMILES: COC1C(CC2CN3CCC4=C(C3CC2C1C(=O)OC)NC5=C4C=C(C=C5)OC)OC(=O)C6=CC(=C(C(=C6)OC)OC)OC.