Enalapril maleate

This classification denotes an ace inhibitor with the molecular formula C20H28N2O5.C4H4O4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 9O25354EPJ, chemically known as l-proline, n-((1s)-1-(ethoxycarbonyl)-3-phenylpropyl)-l-alanyl- but more generally known as enalapril maleate, which bears US NIH Compound Identifier 5362032. European Medicines Agency schedules Enalapril maleate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB01884MIG. Most nations, for tariff and trade purposes, schedule enalapril maleate under HS 29339990 and SITC 51577. As of Q4 2014, ENALAPRIL MALEATE remains US FDA's Preferred Term for this commodity. Enalapril maleate bears US NLM identifiers UMLS ID C0600128 and NCI Concept Code C468. SMILES: CCOC(=O)[C@H](CCC1CCCCC1)N[C@@H](C)C(=O)N2CCC[C@H]2C(=O)O.C(=C\C(=O)O)\C(=O)O.