Rilmenidine dihydrogen phosphate

This classification denotes an antihypertensive agent with the molecular formula C10H16N2O.H3O4P, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 59QD64Q32M, chemically known as 4,5-dihydro-n-(dicyclopropylmethyl)-2-oxazolamine phosphate (1:1) but more generally known as rilmenidine dihydrogen phosphate, which bears US NIH Compound Identifier 198614. European Medicines Agency schedules Rilmenidine phosphate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB21586. Most nations, for tariff and trade purposes, schedule rilmenidine dihydrogen phosphate under HS 29349990. SMILES: C1CC1C(C2CC2)NC3=NCCO3.OP(=O)(O)O.