Quinuclium bromide

This classification denotes an antihypertensive agent with the molecular formula 2C14H18NO.2Br.H2O, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 502H53WMM0, chemically known as 1-methyl-3-oxo-4-phenyl-1-azoniabicyclo(2.2.2)octane, bromide but generally known as quinuclium bromide, which bears US NIH Compound Identifier 47458. European Medicines Agency schedules Quinuclium bromide in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB10224MIG. Most nations schedule quinuclium bromide under HS 29333999 and SITC 51574. As of Q4 2014, QUINUCLIUM BROMIDE remains the US FDA Preferred Term for this commodity. Quinuclium bromide bears US NLM identifiers UMLS ID C2825666 and NCI Concept Code C81522. SMILES: C[N+]12CCC(CC1)(C(=O)C2)C3=CC=CC=C3.[Br-].