Pelanserin hydrochloride

This classification denotes a serotonin antagonist C21H24N4O2.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 4J8I18ZP0A, chemically known as 3-(3-(4-phenyl-1-piperazinyl)propyl)-2,4(1h,3h)-quinazolinedione monohydrochloride, but more generally known as pelanserin hydrochloride, which bears US NIH Compound Identifier 65436. Most nations, for tariff and trade purposes, schedule pelanserin hydrochloride under HS 29335995 and SITC 51576. As of Q4 2014, PELANSERIN HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Pelanserin hydrochloride bears US NLM identifiers UMLS ID C2698754 and NCI Concept Code C76966. SMILES: C1CCC(CC1)N2CCN(CC2)CCCN3C(=O)C4CCCCC4[NH]C3=O.CL.